C19H21ClN2O4 — CID 7603347
[2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-(2-hydroxyethylamino)benzoate (PubChem CID 7603347) has the molecular formula C19H21ClN2O4 and a molecular weight of 376.84 g/mol. Its IUPAC name is [2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-(2-hydroxyethylamino)benzoate.
| Compound Name | [2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-(2-hydroxyethylamino)benzoate |
|---|---|
| PubChem CID | 7603347 |
| Molecular Formula | C19H21ClN2O4 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | [2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-(2-hydroxyethylamino)benzoate |
| SMILES | C[C@H](NC(=O)COC(=O)c1ccccc1NCCO)c1ccccc1Cl |
| InChI | InChI=1S/C19H21ClN2O4/c1-13(14-6-2-4-8-16(14)20)22-18(24)12-26-19(25)15-7-3-5-9-17(15)21-10-11-23/h2-9,13,21,23H,10-12H2,1H3,(H,22,24)/t13-/m0/s1 |
| InChIKey | ARIZPFLSOQCQNJ-ZDUSSCGKSA-N |
| XLogP | 2.78 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |