C24H23NO3 — CID 2338198
[2-(3,4-dimethylanilino)-2-oxoethyl] 2-benzylbenzoate (PubChem CID 2338198) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is [2-(3,4-dimethylanilino)-2-oxoethyl] 2-benzylbenzoate.
| Compound Name | [2-(3,4-dimethylanilino)-2-oxoethyl] 2-benzylbenzoate |
|---|---|
| PubChem CID | 2338198 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | [2-(3,4-dimethylanilino)-2-oxoethyl] 2-benzylbenzoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2ccccc2Cc2ccccc2)cc1C |
| InChI | InChI=1S/C24H23NO3/c1-17-12-13-21(14-18(17)2)25-23(26)16-28-24(27)22-11-7-6-10-20(22)15-19-8-4-3-5-9-19/h3-14H,15-16H2,1-2H3,(H,25,26) |
| InChIKey | BGDINKWQLIOEFQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |