C23H20Br2O2 — CID 102160109
[3,5-bis(bromomethyl)phenyl]methyl 2-benzylbenzoate (PubChem CID 102160109) has the molecular formula C23H20Br2O2 and a molecular weight of 488.22 g/mol. Its IUPAC name is [3,5-bis(bromomethyl)phenyl]methyl 2-benzylbenzoate.
| Compound Name | [3,5-bis(bromomethyl)phenyl]methyl 2-benzylbenzoate |
|---|---|
| PubChem CID | 102160109 |
| Molecular Formula | C23H20Br2O2 |
| Molecular Weight | 488.22 g/mol |
| Exact Mass | 485.98 |
| IUPAC Name | [3,5-bis(bromomethyl)phenyl]methyl 2-benzylbenzoate |
| SMILES | O=C(OCc1cc(CBr)cc(CBr)c1)c1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C23H20Br2O2/c24-14-18-10-19(15-25)12-20(11-18)16-27-23(26)22-9-5-4-8-21(22)13-17-6-2-1-3-7-17/h1-12H,13-16H2 |
| InChIKey | JAYSRNVYSWZESH-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.22 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|