C23H20N4O2 — CID 3008595
(2,4-diaminoquinazolin-6-yl)methyl 2-benzylbenzoate (PubChem CID 3008595) has the molecular formula C23H20N4O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is (2,4-diaminoquinazolin-6-yl)methyl 2-benzylbenzoate.
| Compound Name | (2,4-diaminoquinazolin-6-yl)methyl 2-benzylbenzoate |
|---|---|
| PubChem CID | 3008595 |
| Molecular Formula | C23H20N4O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (2,4-diaminoquinazolin-6-yl)methyl 2-benzylbenzoate |
| SMILES | Nc1nc(N)c2cc(COC(=O)c3ccccc3Cc3ccccc3)ccc2n1 |
| InChI | InChI=1S/C23H20N4O2/c24-21-19-13-16(10-11-20(19)26-23(25)27-21)14-29-22(28)18-9-5-4-8-17(18)12-15-6-2-1-3-7-15/h1-11,13H,12,14H2,(H4,24,25,26,27) |
| InChIKey | VNEURDSMQLYPSF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |