C16H15F3N2O2 — CID 71608505
ethyl 2-amino-5-benzyl-6-(trifluoromethyl)pyridine-3-carboxylate (PubChem CID 71608505) has the molecular formula C16H15F3N2O2 and a molecular weight of 324.30 g/mol. Its IUPAC name is ethyl 2-amino-5-benzyl-6-(trifluoromethyl)pyridine-3-carboxylate.
| Compound Name | ethyl 2-amino-5-benzyl-6-(trifluoromethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 71608505 |
| Molecular Formula | C16H15F3N2O2 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | ethyl 2-amino-5-benzyl-6-(trifluoromethyl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(Cc2ccccc2)c(C(F)(F)F)nc1N |
| InChI | InChI=1S/C16H15F3N2O2/c1-2-23-15(22)12-9-11(8-10-6-4-3-5-7-10)13(16(17,18)19)21-14(12)20/h3-7,9H,2,8H2,1H3,(H2,20,21) |
| InChIKey | CEVGKQBTTJJKNO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |