C22H20N4O4 — CID 161289500
2-aminoquinoline-3-carboxylic acid;ethyl 2-aminoquinoline-3-carboxylate (PubChem CID 161289500) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is 2-aminoquinoline-3-carboxylic acid;ethyl 2-aminoquinoline-3-carboxylate.
| Compound Name | 2-aminoquinoline-3-carboxylic acid;ethyl 2-aminoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 161289500 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 2-aminoquinoline-3-carboxylic acid;ethyl 2-aminoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cc2ccccc2nc1N.Nc1nc2ccccc2cc1C(=O)O |
| InChI | InChI=1S/C12H12N2O2.C10H8N2O2/c1-2-16-12(15)9-7-8-5-3-4-6-10(8)14-11(9)13;11-9-7(10(13)14)5-6-3-1-2-4-8(6)12-9/h3-7H,2H2,1H3,(H2,13,14);1-5H,(H2,11,12)(H,13,14) |
| InChIKey | VGDXDGGANXWFAT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 141.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |