C16H11N5O9 — CID 2750069
2-aminoquinoline-3-carboxylic acid;2,4,6-trinitrophenol (PubChem CID 2750069) has the molecular formula C16H11N5O9 and a molecular weight of 417.29 g/mol. Its IUPAC name is 2-aminoquinoline-3-carboxylic acid;2,4,6-trinitrophenol.
| Compound Name | 2-aminoquinoline-3-carboxylic acid;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 2750069 |
| Molecular Formula | C16H11N5O9 |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 2-aminoquinoline-3-carboxylic acid;2,4,6-trinitrophenol |
| SMILES | Nc1nc2ccccc2cc1C(=O)O.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H8N2O2.C6H3N3O7/c11-9-7(10(13)14)5-6-3-1-2-4-8(6)12-9;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-5H,(H2,11,12)(H,13,14);1-2,10H |
| InChIKey | LDSGSKDDOZHJBN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 225.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|