C6H3CoN3O7 — CID 88826081
cobalt;2,4,6-trinitrophenol (PubChem CID 88826081) has the molecular formula C6H3CoN3O7 and a molecular weight of 288.04 g/mol. Its IUPAC name is cobalt;2,4,6-trinitrophenol.
| Compound Name | cobalt;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 88826081 |
| Molecular Formula | C6H3CoN3O7 |
| Molecular Weight | 288.04 g/mol |
| Exact Mass | 287.93 |
| IUPAC Name | cobalt;2,4,6-trinitrophenol |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.[Co] |
| InChI | InChI=1S/C6H3N3O7.Co/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;/h1-2,10H; |
| InChIKey | DLRYUFQRVJPTMM-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 149.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.04 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|