C6H5BaN3O7 — CID 173341172
barium(2+);hydride;2,4,6-trinitrophenol (PubChem CID 173341172) has the molecular formula C6H5BaN3O7 and a molecular weight of 368.45 g/mol. Its IUPAC name is barium(2+);hydride;2,4,6-trinitrophenol.
| Compound Name | barium(2+);hydride;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 173341172 |
| Molecular Formula | C6H5BaN3O7 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.92 |
| IUPAC Name | barium(2+);hydride;2,4,6-trinitrophenol |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.[Ba+2].[H-].[H-] |
| InChI | InChI=1S/C6H3N3O7.Ba.2H/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;;;/h1-2,10H;;;/q;+2;2*-1 |
| InChIKey | PHBSKVAKPBDIPW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 149.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|