About sodium;hydride;2-methyl-4,6-dinitrophenol
sodium;hydride;2-methyl-4,6-dinitrophenol (PubChem CID 173366474) has the molecular formula C7H7N2NaO5
and a molecular weight of 222.13 g/mol. Its IUPAC name is sodium;hydride;2-methyl-4,6-dinitrophenol.
Molecular Properties
| Compound Name | sodium;hydride;2-methyl-4,6-dinitrophenol |
| PubChem CID | 173366474 |
| Molecular Formula | C7H7N2NaO5 |
| Molecular Weight | 222.13 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | sodium;hydride;2-methyl-4,6-dinitrophenol |
| SMILES | Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O.[H-].[Na+] |
| InChI | InChI=1S/C7H6N2O5.Na.H/c1-4-2-5(8(11)12)3-6(7(4)10)9(13)14;;/h2-3,10H,1H3;;/q;+1;-1 |
| InChIKey | VMUNFBPKLWIZGD-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.13 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;2-methyl-4,6-dinitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;2-methyl-4,6-dinitrophenol?
The IUPAC name of sodium;hydride;2-methyl-4,6-dinitrophenol (CID 173366474) is sodium;hydride;2-methyl-4,6-dinitrophenol.
What is the SMILES notation for sodium;hydride;2-methyl-4,6-dinitrophenol?
The canonical SMILES for sodium;hydride;2-methyl-4,6-dinitrophenol is Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O.[H-].[Na+].
What is the InChIKey of sodium;hydride;2-methyl-4,6-dinitrophenol?
The InChIKey is VMUNFBPKLWIZGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O5.Na.H/c1-4-2-5(8(11)12)3-6(7(4)10)9(13)14;;/h2-3,10H,1H3;;/q;+1;-1.
What are the key properties of sodium;hydride;2-methyl-4,6-dinitrophenol?
sodium;hydride;2-methyl-4,6-dinitrophenol has a molecular weight of 222.13 g/mol, XLogP of -1.37, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;2-methyl-4,6-dinitrophenol is sourced from PubChem (CID 173366474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).