C11H19NO3 — CID 143297334
2,6-dimethyl-4-nitrophenol;ethane;methane (PubChem CID 143297334) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2,6-dimethyl-4-nitrophenol;ethane;methane.
| Compound Name | 2,6-dimethyl-4-nitrophenol;ethane;methane |
|---|---|
| PubChem CID | 143297334 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 2,6-dimethyl-4-nitrophenol;ethane;methane |
| SMILES | C.CC.Cc1cc([N+](=O)[O-])cc(C)c1O |
| InChI | InChI=1S/C8H9NO3.C2H6.CH4/c1-5-3-7(9(11)12)4-6(2)8(5)10;1-2;/h3-4,10H,1-2H3;1-2H3;1H4 |
| InChIKey | NZKSHYYLYBIMLG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|