C16H15NO3 — CID 68740583
2,6-dimethyl-4-[2-(4-nitrophenyl)ethenyl]phenol (PubChem CID 68740583) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2,6-dimethyl-4-[2-(4-nitrophenyl)ethenyl]phenol.
| Compound Name | 2,6-dimethyl-4-[2-(4-nitrophenyl)ethenyl]phenol |
|---|---|
| PubChem CID | 68740583 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 2,6-dimethyl-4-[2-(4-nitrophenyl)ethenyl]phenol |
| SMILES | Cc1cc(C=Cc2ccc([N+](=O)[O-])cc2)cc(C)c1O |
| InChI | InChI=1S/C16H15NO3/c1-11-9-14(10-12(2)16(11)18)4-3-13-5-7-15(8-6-13)17(19)20/h3-10,18H,1-2H3 |
| InChIKey | JQVXKRUZIJNWAK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|