C14H11NO4 — CID 68740509
5-[2-(4-nitrophenyl)ethenyl]benzene-1,3-diol (PubChem CID 68740509) has the molecular formula C14H11NO4 and a molecular weight of 257.25 g/mol. Its IUPAC name is 5-[2-(4-nitrophenyl)ethenyl]benzene-1,3-diol.
| Compound Name | 5-[2-(4-nitrophenyl)ethenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 68740509 |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 5-[2-(4-nitrophenyl)ethenyl]benzene-1,3-diol |
| SMILES | O=[N+]([O-])c1ccc(C=Cc2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C14H11NO4/c16-13-7-11(8-14(17)9-13)2-1-10-3-5-12(6-4-10)15(18)19/h1-9,16-17H |
| InChIKey | JJNQRIBTBNZQBJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|