About 4-nitrophenol
4-nitrophenol (PubChem CID 88714583) has the molecular formula C12H10N2O6
and a molecular weight of 278.22 g/mol. Its IUPAC name is 4-nitrophenol.
Molecular Properties
| Compound Name | 4-nitrophenol |
| PubChem CID | 88714583 |
| Molecular Formula | C12H10N2O6 |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 4-nitrophenol |
| SMILES | O=[N+]([O-])c1ccc(O)cc1.O=[N+]([O-])c1ccc(O)cc1 |
| InChI | InChI=1S/2C6H5NO3/c2*8-6-3-1-5(2-4-6)7(9)10/h2*1-4,8H |
| InChIKey | FYKHWKNFKLTGNX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitrophenol?
The IUPAC name of 4-nitrophenol (CID 88714583) is 4-nitrophenol.
What is the SMILES notation for 4-nitrophenol?
The canonical SMILES for 4-nitrophenol is O=[N+]([O-])c1ccc(O)cc1.O=[N+]([O-])c1ccc(O)cc1.
What is the InChIKey of 4-nitrophenol?
The InChIKey is FYKHWKNFKLTGNX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H5NO3/c2*8-6-3-1-5(2-4-6)7(9)10/h2*1-4,8H.
What are the key properties of 4-nitrophenol?
4-nitrophenol has a molecular weight of 278.22 g/mol, XLogP of 2.60, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitrophenol is sourced from PubChem (CID 88714583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).