1,4-dinitrobenzene;nitrous acid

C6H5N3O6 — CID 174371180

IUPAC1,4-dinitrobenzene;nitrous acid
SMILESO=NO.O=[N+]([O-])c1ccc([N+](=O)[O-])cc1
InChIInChI=1S/C6H4N2O4.HNO2/c9-7(10)5-1-2-6(4-3-5)8(11)12;2-1-3/h1-4H;(H,2,3)
InChIKeyCXYAKKCOGQXQPY-UHFFFAOYSA-N
MW215.12 g/mol
LogP1.64
Rot. Bonds2

About 1,4-dinitrobenzene;nitrous acid

1,4-dinitrobenzene;nitrous acid (PubChem CID 174371180) has the molecular formula C6H5N3O6 and a molecular weight of 215.12 g/mol. Its IUPAC name is 1,4-dinitrobenzene;nitrous acid.

Molecular Properties

Compound Name1,4-dinitrobenzene;nitrous acid
PubChem CID174371180
Molecular FormulaC6H5N3O6
Molecular Weight215.12 g/mol
Exact Mass215.02
IUPAC Name1,4-dinitrobenzene;nitrous acid
SMILESO=NO.O=[N+]([O-])c1ccc([N+](=O)[O-])cc1
InChIInChI=1S/C6H4N2O4.HNO2/c9-7(10)5-1-2-6(4-3-5)8(11)12;2-1-3/h1-4H;(H,2,3)
InChIKeyCXYAKKCOGQXQPY-UHFFFAOYSA-N
XLogP1.64
TPSA135.94 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.12
LogP ≤ 51.64
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 1,4-dinitrobenzene;nitrous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,4-dinitrobenzene;nitrous acid?
The IUPAC name of 1,4-dinitrobenzene;nitrous acid (CID 174371180) is 1,4-dinitrobenzene;nitrous acid.
What is the SMILES notation for 1,4-dinitrobenzene;nitrous acid?
The canonical SMILES for 1,4-dinitrobenzene;nitrous acid is O=NO.O=[N+]([O-])c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 1,4-dinitrobenzene;nitrous acid?
The InChIKey is CXYAKKCOGQXQPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O4.HNO2/c9-7(10)5-1-2-6(4-3-5)8(11)12;2-1-3/h1-4H;(H,2,3).
What are the key properties of 1,4-dinitrobenzene;nitrous acid?
1,4-dinitrobenzene;nitrous acid has a molecular weight of 215.12 g/mol, XLogP of 1.64, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dinitrobenzene;nitrous acid is sourced from PubChem (CID 174371180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).