About 1,4-dinitrobenzene;nitrous acid
1,4-dinitrobenzene;nitrous acid (PubChem CID 174371180) has the molecular formula C6H5N3O6
and a molecular weight of 215.12 g/mol. Its IUPAC name is 1,4-dinitrobenzene;nitrous acid.
Molecular Properties
| Compound Name | 1,4-dinitrobenzene;nitrous acid |
| PubChem CID | 174371180 |
| Molecular Formula | C6H5N3O6 |
| Molecular Weight | 215.12 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | 1,4-dinitrobenzene;nitrous acid |
| SMILES | O=NO.O=[N+]([O-])c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C6H4N2O4.HNO2/c9-7(10)5-1-2-6(4-3-5)8(11)12;2-1-3/h1-4H;(H,2,3) |
| InChIKey | CXYAKKCOGQXQPY-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 135.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.12 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dinitrobenzene;nitrous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dinitrobenzene;nitrous acid?
The IUPAC name of 1,4-dinitrobenzene;nitrous acid (CID 174371180) is 1,4-dinitrobenzene;nitrous acid.
What is the SMILES notation for 1,4-dinitrobenzene;nitrous acid?
The canonical SMILES for 1,4-dinitrobenzene;nitrous acid is O=NO.O=[N+]([O-])c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 1,4-dinitrobenzene;nitrous acid?
The InChIKey is CXYAKKCOGQXQPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O4.HNO2/c9-7(10)5-1-2-6(4-3-5)8(11)12;2-1-3/h1-4H;(H,2,3).
What are the key properties of 1,4-dinitrobenzene;nitrous acid?
1,4-dinitrobenzene;nitrous acid has a molecular weight of 215.12 g/mol, XLogP of 1.64, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dinitrobenzene;nitrous acid is sourced from PubChem (CID 174371180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).