About 2-chloro-5-nitropyridine;nitrous acid
2-chloro-5-nitropyridine;nitrous acid (PubChem CID 118129772) has the molecular formula C5H4ClN3O4
and a molecular weight of 205.56 g/mol. Its IUPAC name is 2-chloro-5-nitropyridine;nitrous acid.
Molecular Properties
| Compound Name | 2-chloro-5-nitropyridine;nitrous acid |
| PubChem CID | 118129772 |
| Molecular Formula | C5H4ClN3O4 |
| Molecular Weight | 205.56 g/mol |
| Exact Mass | 204.99 |
| IUPAC Name | 2-chloro-5-nitropyridine;nitrous acid |
| SMILES | O=NO.O=[N+]([O-])c1ccc(Cl)nc1 |
| InChI | InChI=1S/C5H3ClN2O2.HNO2/c6-5-2-1-4(3-7-5)8(9)10;2-1-3/h1-3H;(H,2,3) |
| InChIKey | WCYLQDTYIXSMQG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.56 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-nitropyridine;nitrous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-nitropyridine;nitrous acid?
The IUPAC name of 2-chloro-5-nitropyridine;nitrous acid (CID 118129772) is 2-chloro-5-nitropyridine;nitrous acid.
What is the SMILES notation for 2-chloro-5-nitropyridine;nitrous acid?
The canonical SMILES for 2-chloro-5-nitropyridine;nitrous acid is O=NO.O=[N+]([O-])c1ccc(Cl)nc1.
What is the InChIKey of 2-chloro-5-nitropyridine;nitrous acid?
The InChIKey is WCYLQDTYIXSMQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3ClN2O2.HNO2/c6-5-2-1-4(3-7-5)8(9)10;2-1-3/h1-3H;(H,2,3).
What are the key properties of 2-chloro-5-nitropyridine;nitrous acid?
2-chloro-5-nitropyridine;nitrous acid has a molecular weight of 205.56 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-nitropyridine;nitrous acid is sourced from PubChem (CID 118129772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).