About methane;5-nitropyridin-2-amine
methane;5-nitropyridin-2-amine (PubChem CID 174857781) has the molecular formula C6H9N3O2
and a molecular weight of 155.16 g/mol. Its IUPAC name is methane;5-nitropyridin-2-amine.
Molecular Properties
| Compound Name | methane;5-nitropyridin-2-amine |
| PubChem CID | 174857781 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | methane;5-nitropyridin-2-amine |
| SMILES | C.Nc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C5H5N3O2.CH4/c6-5-2-1-4(3-7-5)8(9)10;/h1-3H,(H2,6,7);1H4 |
| InChIKey | NOROAJXGNNSZMJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methane;5-nitropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;5-nitropyridin-2-amine?
The IUPAC name of methane;5-nitropyridin-2-amine (CID 174857781) is methane;5-nitropyridin-2-amine.
What is the SMILES notation for methane;5-nitropyridin-2-amine?
The canonical SMILES for methane;5-nitropyridin-2-amine is C.Nc1ccc([N+](=O)[O-])cn1.
What is the InChIKey of methane;5-nitropyridin-2-amine?
The InChIKey is NOROAJXGNNSZMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O2.CH4/c6-5-2-1-4(3-7-5)8(9)10;/h1-3H,(H2,6,7);1H4.
What are the key properties of methane;5-nitropyridin-2-amine?
methane;5-nitropyridin-2-amine has a molecular weight of 155.16 g/mol, XLogP of 1.21, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;5-nitropyridin-2-amine is sourced from PubChem (CID 174857781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).