About 2-chloro-5-nitropyridine;6-chloropyridin-3-amine
2-chloro-5-nitropyridine;6-chloropyridin-3-amine (PubChem CID 87669080) has the molecular formula C10H8Cl2N4O2
and a molecular weight of 287.11 g/mol. Its IUPAC name is 2-chloro-5-nitropyridine;6-chloropyridin-3-amine.
Molecular Properties
| Compound Name | 2-chloro-5-nitropyridine;6-chloropyridin-3-amine |
| PubChem CID | 87669080 |
| Molecular Formula | C10H8Cl2N4O2 |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 2-chloro-5-nitropyridine;6-chloropyridin-3-amine |
| SMILES | Nc1ccc(Cl)nc1.O=[N+]([O-])c1ccc(Cl)nc1 |
| InChI | InChI=1S/C5H3ClN2O2.C5H5ClN2/c6-5-2-1-4(3-7-5)8(9)10;6-5-2-1-4(7)3-8-5/h1-3H;1-3H,7H2 |
| InChIKey | XQGPOQWXGQKIMT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-nitropyridine;6-chloropyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-nitropyridine;6-chloropyridin-3-amine?
The IUPAC name of 2-chloro-5-nitropyridine;6-chloropyridin-3-amine (CID 87669080) is 2-chloro-5-nitropyridine;6-chloropyridin-3-amine.
What is the SMILES notation for 2-chloro-5-nitropyridine;6-chloropyridin-3-amine?
The canonical SMILES for 2-chloro-5-nitropyridine;6-chloropyridin-3-amine is Nc1ccc(Cl)nc1.O=[N+]([O-])c1ccc(Cl)nc1.
What is the InChIKey of 2-chloro-5-nitropyridine;6-chloropyridin-3-amine?
The InChIKey is XQGPOQWXGQKIMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3ClN2O2.C5H5ClN2/c6-5-2-1-4(3-7-5)8(9)10;6-5-2-1-4(7)3-8-5/h1-3H;1-3H,7H2.
What are the key properties of 2-chloro-5-nitropyridine;6-chloropyridin-3-amine?
2-chloro-5-nitropyridine;6-chloropyridin-3-amine has a molecular weight of 287.11 g/mol, XLogP of 2.96, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-nitropyridine;6-chloropyridin-3-amine is sourced from PubChem (CID 87669080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).