About methanamine;4-nitroaniline
methanamine;4-nitroaniline (PubChem CID 22708932) has the molecular formula C7H11N3O2
and a molecular weight of 169.18 g/mol. Its IUPAC name is methanamine;4-nitroaniline.
Molecular Properties
| Compound Name | methanamine;4-nitroaniline |
| PubChem CID | 22708932 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | methanamine;4-nitroaniline |
| SMILES | CN.Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C6H6N2O2.CH5N/c7-5-1-3-6(4-2-5)8(9)10;1-2/h1-4H,7H2;2H2,1H3 |
| InChIKey | OUYCBQQPZPDUIO-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methanamine;4-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;4-nitroaniline?
The IUPAC name of methanamine;4-nitroaniline (CID 22708932) is methanamine;4-nitroaniline.
What is the SMILES notation for methanamine;4-nitroaniline?
The canonical SMILES for methanamine;4-nitroaniline is CN.Nc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of methanamine;4-nitroaniline?
The InChIKey is OUYCBQQPZPDUIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2.CH5N/c7-5-1-3-6(4-2-5)8(9)10;1-2/h1-4H,7H2;2H2,1H3.
What are the key properties of methanamine;4-nitroaniline?
methanamine;4-nitroaniline has a molecular weight of 169.18 g/mol, XLogP of 0.75, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;4-nitroaniline is sourced from PubChem (CID 22708932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).