About azane;formic acid;4-nitroaniline
azane;formic acid;4-nitroaniline (PubChem CID 175013455) has the molecular formula C7H11N3O4
and a molecular weight of 201.18 g/mol. Its IUPAC name is azane;formic acid;4-nitroaniline.
Molecular Properties
| Compound Name | azane;formic acid;4-nitroaniline |
| PubChem CID | 175013455 |
| Molecular Formula | C7H11N3O4 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | azane;formic acid;4-nitroaniline |
| SMILES | N.Nc1ccc([N+](=O)[O-])cc1.O=CO |
| InChI | InChI=1S/C6H6N2O2.CH2O2.H3N/c7-5-1-3-6(4-2-5)8(9)10;2-1-3;/h1-4H,7H2;1H,(H,2,3);1H3 |
| InChIKey | BLPCQINASVZKBU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 141.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;formic acid;4-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;formic acid;4-nitroaniline?
The IUPAC name of azane;formic acid;4-nitroaniline (CID 175013455) is azane;formic acid;4-nitroaniline.
What is the SMILES notation for azane;formic acid;4-nitroaniline?
The canonical SMILES for azane;formic acid;4-nitroaniline is N.Nc1ccc([N+](=O)[O-])cc1.O=CO.
What is the InChIKey of azane;formic acid;4-nitroaniline?
The InChIKey is BLPCQINASVZKBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2.CH2O2.H3N/c7-5-1-3-6(4-2-5)8(9)10;2-1-3;/h1-4H,7H2;1H,(H,2,3);1H3.
What are the key properties of azane;formic acid;4-nitroaniline?
azane;formic acid;4-nitroaniline has a molecular weight of 201.18 g/mol, XLogP of 1.04, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;formic acid;4-nitroaniline is sourced from PubChem (CID 175013455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).