C18H18N2O4 — CID 91547791
3-(4-aminophenyl)-4-(4-nitrophenyl)hexane-2,5-dione (PubChem CID 91547791) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 3-(4-aminophenyl)-4-(4-nitrophenyl)hexane-2,5-dione.
| Compound Name | 3-(4-aminophenyl)-4-(4-nitrophenyl)hexane-2,5-dione |
|---|---|
| PubChem CID | 91547791 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 3-(4-aminophenyl)-4-(4-nitrophenyl)hexane-2,5-dione |
| SMILES | CC(=O)C(c1ccc(N)cc1)C(C(C)=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H18N2O4/c1-11(21)17(13-3-7-15(19)8-4-13)18(12(2)22)14-5-9-16(10-6-14)20(23)24/h3-10,17-18H,19H2,1-2H3 |
| InChIKey | LSNOKLYXLATSMT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|