About 4-nitroaniline;perchloric acid
4-nitroaniline;perchloric acid (PubChem CID 86177986) has the molecular formula C6H7ClN2O6
and a molecular weight of 238.58 g/mol. Its IUPAC name is 4-nitroaniline;perchloric acid.
Molecular Properties
| Compound Name | 4-nitroaniline;perchloric acid |
| PubChem CID | 86177986 |
| Molecular Formula | C6H7ClN2O6 |
| Molecular Weight | 238.58 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | 4-nitroaniline;perchloric acid |
| SMILES | Nc1ccc([N+](=O)[O-])cc1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C6H6N2O2.ClHO4/c7-5-1-3-6(4-2-5)8(9)10;2-1(3,4)5/h1-4H,7H2;(H,2,3,4,5) |
| InChIKey | AULSMOHJCCOPMB-UHFFFAOYSA-N |
| XLogP | -2.95 |
| TPSA | 158.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.58 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitroaniline;perchloric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitroaniline;perchloric acid?
The IUPAC name of 4-nitroaniline;perchloric acid (CID 86177986) is 4-nitroaniline;perchloric acid.
What is the SMILES notation for 4-nitroaniline;perchloric acid?
The canonical SMILES for 4-nitroaniline;perchloric acid is Nc1ccc([N+](=O)[O-])cc1.[O-][Cl+3]([O-])([O-])O.
What is the InChIKey of 4-nitroaniline;perchloric acid?
The InChIKey is AULSMOHJCCOPMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2.ClHO4/c7-5-1-3-6(4-2-5)8(9)10;2-1(3,4)5/h1-4H,7H2;(H,2,3,4,5).
What are the key properties of 4-nitroaniline;perchloric acid?
4-nitroaniline;perchloric acid has a molecular weight of 238.58 g/mol, XLogP of -2.95, 1 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitroaniline;perchloric acid is sourced from PubChem (CID 86177986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).