About 4-nitroaniline;4-(trifluoromethyl)aniline
4-nitroaniline;4-(trifluoromethyl)aniline (PubChem CID 175448311) has the molecular formula C13H12F3N3O2
and a molecular weight of 299.25 g/mol. Its IUPAC name is 4-nitroaniline;4-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | 4-nitroaniline;4-(trifluoromethyl)aniline |
| PubChem CID | 175448311 |
| Molecular Formula | C13H12F3N3O2 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 4-nitroaniline;4-(trifluoromethyl)aniline |
| SMILES | Nc1ccc(C(F)(F)F)cc1.Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C7H6F3N.C6H6N2O2/c8-7(9,10)5-1-3-6(11)4-2-5;7-5-1-3-6(4-2-5)8(9)10/h1-4H,11H2;1-4H,7H2 |
| InChIKey | VZQNZJSDELAUHC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitroaniline;4-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitroaniline;4-(trifluoromethyl)aniline?
The IUPAC name of 4-nitroaniline;4-(trifluoromethyl)aniline (CID 175448311) is 4-nitroaniline;4-(trifluoromethyl)aniline.
What is the SMILES notation for 4-nitroaniline;4-(trifluoromethyl)aniline?
The canonical SMILES for 4-nitroaniline;4-(trifluoromethyl)aniline is Nc1ccc(C(F)(F)F)cc1.Nc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 4-nitroaniline;4-(trifluoromethyl)aniline?
The InChIKey is VZQNZJSDELAUHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F3N.C6H6N2O2/c8-7(9,10)5-1-3-6(11)4-2-5;7-5-1-3-6(4-2-5)8(9)10/h1-4H,11H2;1-4H,7H2.
What are the key properties of 4-nitroaniline;4-(trifluoromethyl)aniline?
4-nitroaniline;4-(trifluoromethyl)aniline has a molecular weight of 299.25 g/mol, XLogP of 3.46, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitroaniline;4-(trifluoromethyl)aniline is sourced from PubChem (CID 175448311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).