About molecular nitrogen;4-nitroaniline;hydrochloride
molecular nitrogen;4-nitroaniline;hydrochloride (PubChem CID 175091269) has the molecular formula C6H7ClN4O2
and a molecular weight of 202.60 g/mol. Its IUPAC name is molecular nitrogen;4-nitroaniline;hydrochloride.
Molecular Properties
| Compound Name | molecular nitrogen;4-nitroaniline;hydrochloride |
| PubChem CID | 175091269 |
| Molecular Formula | C6H7ClN4O2 |
| Molecular Weight | 202.60 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | molecular nitrogen;4-nitroaniline;hydrochloride |
| SMILES | Cl.N#N.Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C6H6N2O2.ClH.N2/c7-5-1-3-6(4-2-5)8(9)10;;1-2/h1-4H,7H2;1H; |
| InChIKey | JFWMKSSXAFDBSX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 116.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.60 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze molecular nitrogen;4-nitroaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular nitrogen;4-nitroaniline;hydrochloride?
The IUPAC name of molecular nitrogen;4-nitroaniline;hydrochloride (CID 175091269) is molecular nitrogen;4-nitroaniline;hydrochloride.
What is the SMILES notation for molecular nitrogen;4-nitroaniline;hydrochloride?
The canonical SMILES for molecular nitrogen;4-nitroaniline;hydrochloride is Cl.N#N.Nc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of molecular nitrogen;4-nitroaniline;hydrochloride?
The InChIKey is JFWMKSSXAFDBSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2.ClH.N2/c7-5-1-3-6(4-2-5)8(9)10;;1-2/h1-4H,7H2;1H;.
What are the key properties of molecular nitrogen;4-nitroaniline;hydrochloride?
molecular nitrogen;4-nitroaniline;hydrochloride has a molecular weight of 202.60 g/mol, XLogP of 1.63, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for molecular nitrogen;4-nitroaniline;hydrochloride is sourced from PubChem (CID 175091269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).