About dihydroxy(oxo)phosphanium;4-nitroaniline
dihydroxy(oxo)phosphanium;4-nitroaniline (PubChem CID 174379615) has the molecular formula C6H8N2O5P+
and a molecular weight of 219.11 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;4-nitroaniline.
Molecular Properties
| Compound Name | dihydroxy(oxo)phosphanium;4-nitroaniline |
| PubChem CID | 174379615 |
| Molecular Formula | C6H8N2O5P+ |
| Molecular Weight | 219.11 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | dihydroxy(oxo)phosphanium;4-nitroaniline |
| SMILES | Nc1ccc([N+](=O)[O-])cc1.O=[P+](O)O |
| InChI | InChI=1S/C6H6N2O2.HO3P/c7-5-1-3-6(4-2-5)8(9)10;1-4(2)3/h1-4H,7H2;(H-,1,2,3)/p+1 |
| InChIKey | ZFGBZWCJBIOGCX-UHFFFAOYSA-O |
| XLogP | 0.81 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.11 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)phosphanium;4-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)phosphanium;4-nitroaniline?
The IUPAC name of dihydroxy(oxo)phosphanium;4-nitroaniline (CID 174379615) is dihydroxy(oxo)phosphanium;4-nitroaniline.
What is the SMILES notation for dihydroxy(oxo)phosphanium;4-nitroaniline?
The canonical SMILES for dihydroxy(oxo)phosphanium;4-nitroaniline is Nc1ccc([N+](=O)[O-])cc1.O=[P+](O)O.
What is the InChIKey of dihydroxy(oxo)phosphanium;4-nitroaniline?
The InChIKey is ZFGBZWCJBIOGCX-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H6N2O2.HO3P/c7-5-1-3-6(4-2-5)8(9)10;1-4(2)3/h1-4H,7H2;(H-,1,2,3)/p+1.
What are the key properties of dihydroxy(oxo)phosphanium;4-nitroaniline?
dihydroxy(oxo)phosphanium;4-nitroaniline has a molecular weight of 219.11 g/mol, XLogP of 0.81, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)phosphanium;4-nitroaniline is sourced from PubChem (CID 174379615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).