About (4-aminophenyl)methyl acetate;(4-nitrophenyl)methyl acetate
(4-aminophenyl)methyl acetate;(4-nitrophenyl)methyl acetate (PubChem CID 159369560) has the molecular formula C18H20N2O6
and a molecular weight of 360.37 g/mol. Its IUPAC name is (4-aminophenyl)methyl acetate;(4-nitrophenyl)methyl acetate.
Molecular Properties
| Compound Name | (4-aminophenyl)methyl acetate;(4-nitrophenyl)methyl acetate |
| PubChem CID | 159369560 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (4-aminophenyl)methyl acetate;(4-nitrophenyl)methyl acetate |
| SMILES | CC(=O)OCc1ccc(N)cc1.CC(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H9NO4.C9H11NO2/c1-7(11)14-6-8-2-4-9(5-3-8)10(12)13;1-7(11)12-6-8-2-4-9(10)5-3-8/h2-5H,6H2,1H3;2-5H,6,10H2,1H3 |
| InChIKey | LJOMRMMHSXGUKN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-aminophenyl)methyl acetate;(4-nitrophenyl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminophenyl)methyl acetate;(4-nitrophenyl)methyl acetate?
The IUPAC name of (4-aminophenyl)methyl acetate;(4-nitrophenyl)methyl acetate (CID 159369560) is (4-aminophenyl)methyl acetate;(4-nitrophenyl)methyl acetate.
What is the SMILES notation for (4-aminophenyl)methyl acetate;(4-nitrophenyl)methyl acetate?
The canonical SMILES for (4-aminophenyl)methyl acetate;(4-nitrophenyl)methyl acetate is CC(=O)OCc1ccc(N)cc1.CC(=O)OCc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-aminophenyl)methyl acetate;(4-nitrophenyl)methyl acetate?
The InChIKey is LJOMRMMHSXGUKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO4.C9H11NO2/c1-7(11)14-6-8-2-4-9(5-3-8)10(12)13;1-7(11)12-6-8-2-4-9(10)5-3-8/h2-5H,6H2,1H3;2-5H,6,10H2,1H3.
What are the key properties of (4-aminophenyl)methyl acetate;(4-nitrophenyl)methyl acetate?
(4-aminophenyl)methyl acetate;(4-nitrophenyl)methyl acetate has a molecular weight of 360.37 g/mol, XLogP of 2.99, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminophenyl)methyl acetate;(4-nitrophenyl)methyl acetate is sourced from PubChem (CID 159369560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).