C18H16N2O10 — CID 10432242
bis[(4-nitrophenyl)methyl] (2R,3R)-2,3-dihydroxybutanedioate (PubChem CID 10432242) has the molecular formula C18H16N2O10 and a molecular weight of 420.33 g/mol. Its IUPAC name is bis[(4-nitrophenyl)methyl] (2R,3R)-2,3-dihydroxybutanedioate.
| Compound Name | bis[(4-nitrophenyl)methyl] (2R,3R)-2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 10432242 |
| Molecular Formula | C18H16N2O10 |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | bis[(4-nitrophenyl)methyl] (2R,3R)-2,3-dihydroxybutanedioate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)[C@H](O)[C@@H](O)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H16N2O10/c21-15(17(23)29-9-11-1-5-13(6-2-11)19(25)26)16(22)18(24)30-10-12-3-7-14(8-4-12)20(27)28/h1-8,15-16,21-22H,9-10H2/t15-,16-/m1/s1 |
| InChIKey | UQZNPEGSMLLYNB-HZPDHXFCSA-N |
| XLogP | 1.01 |
| TPSA | 179.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|