C22H16N2O8 — CID 88636598
bis[(4-nitrophenyl)methyl] benzene-1,2-dicarboxylate (PubChem CID 88636598) has the molecular formula C22H16N2O8 and a molecular weight of 436.38 g/mol. Its IUPAC name is bis[(4-nitrophenyl)methyl] benzene-1,2-dicarboxylate.
| Compound Name | bis[(4-nitrophenyl)methyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 88636598 |
| Molecular Formula | C22H16N2O8 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | bis[(4-nitrophenyl)methyl] benzene-1,2-dicarboxylate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)c1ccccc1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H16N2O8/c25-21(31-13-15-5-9-17(10-6-15)23(27)28)19-3-1-2-4-20(19)22(26)32-14-16-7-11-18(12-8-16)24(29)30/h1-12H,13-14H2 |
| InChIKey | NAIJNOXLTWDGLP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|