C22H25NO6 — CID 91720102
1-O-heptyl 2-O-[(4-nitrophenyl)methyl] benzene-1,2-dicarboxylate (PubChem CID 91720102) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is 1-O-heptyl 2-O-[(4-nitrophenyl)methyl] benzene-1,2-dicarboxylate.
| Compound Name | 1-O-heptyl 2-O-[(4-nitrophenyl)methyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91720102 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 1-O-heptyl 2-O-[(4-nitrophenyl)methyl] benzene-1,2-dicarboxylate |
| SMILES | CCCCCCCOC(=O)c1ccccc1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H25NO6/c1-2-3-4-5-8-15-28-21(24)19-9-6-7-10-20(19)22(25)29-16-17-11-13-18(14-12-17)23(26)27/h6-7,9-14H,2-5,8,15-16H2,1H3 |
| InChIKey | IMIBRLSUNOVBIU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|