C50H80O8 — CID 159101599
dinonyl benzene-1,2-dicarboxylate;dioctyl benzene-1,2-dicarboxylate (PubChem CID 159101599) has the molecular formula C50H80O8 and a molecular weight of 809.18 g/mol. Its IUPAC name is dinonyl benzene-1,2-dicarboxylate;dioctyl benzene-1,2-dicarboxylate.
| Compound Name | dinonyl benzene-1,2-dicarboxylate;dioctyl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 159101599 |
| Molecular Formula | C50H80O8 |
| Molecular Weight | 809.18 g/mol |
| Exact Mass | 808.59 |
| IUPAC Name | dinonyl benzene-1,2-dicarboxylate;dioctyl benzene-1,2-dicarboxylate |
| SMILES | CCCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCCC.CCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCC |
| InChI | InChI=1S/C26H42O4.C24H38O4/c1-3-5-7-9-11-13-17-21-29-25(27)23-19-15-16-20-24(23)26(28)30-22-18-14-12-10-8-6-4-2;1-3-5-7-9-11-15-19-27-23(25)21-17-13-14-18-22(21)24(26)28-20-16-12-10-8-6-4-2/h15-16,19-20H,3-14,17-18,21-22H2,1-2H3;13-14,17-18H,3-12,15-16,19-20H2,1-2H3 |
| InChIKey | KDIWBLQOZVTOKO-UHFFFAOYSA-N |
| XLogP | 14.22 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.18 |
| LogP ≤ 5 | 14.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|