C30H44O4Zn — CID 174864297
benzene;dioctyl benzene-1,2-dicarboxylate;zinc (PubChem CID 174864297) has the molecular formula C30H44O4Zn and a molecular weight of 534.07 g/mol. Its IUPAC name is benzene;dioctyl benzene-1,2-dicarboxylate;zinc.
| Compound Name | benzene;dioctyl benzene-1,2-dicarboxylate;zinc |
|---|---|
| PubChem CID | 174864297 |
| Molecular Formula | C30H44O4Zn |
| Molecular Weight | 534.07 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | benzene;dioctyl benzene-1,2-dicarboxylate;zinc |
| SMILES | CCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCC.[Zn].c1ccccc1 |
| InChI | InChI=1S/C24H38O4.C6H6.Zn/c1-3-5-7-9-11-15-19-27-23(25)21-17-13-14-18-22(21)24(26)28-20-16-12-10-8-6-4-2;1-2-4-6-5-3-1;/h13-14,17-18H,3-12,15-16,19-20H2,1-2H3;1-6H; |
| InChIKey | LNYBQBUYPRKLNY-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.07 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|