About (4-nitrophenyl)methyl (2R)-2-aminopropanoate;hydrobromide
(4-nitrophenyl)methyl (2R)-2-aminopropanoate;hydrobromide (PubChem CID 56845406) has the molecular formula C10H13BrN2O4
and a molecular weight of 305.13 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2R)-2-aminopropanoate;hydrobromide.
Molecular Properties
| Compound Name | (4-nitrophenyl)methyl (2R)-2-aminopropanoate;hydrobromide |
| PubChem CID | 56845406 |
| Molecular Formula | C10H13BrN2O4 |
| Molecular Weight | 305.13 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | (4-nitrophenyl)methyl (2R)-2-aminopropanoate;hydrobromide |
| SMILES | Br.C[C@@H](N)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H12N2O4.BrH/c1-7(11)10(13)16-6-8-2-4-9(5-3-8)12(14)15;/h2-5,7H,6,11H2,1H3;1H/t7-;/m1./s1 |
| InChIKey | FRFKXOAGURTONY-OGFXRTJISA-N |
| XLogP | 1.56 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.13 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)methyl (2R)-2-aminopropanoate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)methyl (2R)-2-aminopropanoate;hydrobromide?
The IUPAC name of (4-nitrophenyl)methyl (2R)-2-aminopropanoate;hydrobromide (CID 56845406) is (4-nitrophenyl)methyl (2R)-2-aminopropanoate;hydrobromide.
What is the SMILES notation for (4-nitrophenyl)methyl (2R)-2-aminopropanoate;hydrobromide?
The canonical SMILES for (4-nitrophenyl)methyl (2R)-2-aminopropanoate;hydrobromide is Br.C[C@@H](N)C(=O)OCc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenyl)methyl (2R)-2-aminopropanoate;hydrobromide?
The InChIKey is FRFKXOAGURTONY-OGFXRTJISA-N. The full InChI is InChI=1S/C10H12N2O4.BrH/c1-7(11)10(13)16-6-8-2-4-9(5-3-8)12(14)15;/h2-5,7H,6,11H2,1H3;1H/t7-;/m1./s1.
What are the key properties of (4-nitrophenyl)methyl (2R)-2-aminopropanoate;hydrobromide?
(4-nitrophenyl)methyl (2R)-2-aminopropanoate;hydrobromide has a molecular weight of 305.13 g/mol, XLogP of 1.56, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)methyl (2R)-2-aminopropanoate;hydrobromide is sourced from PubChem (CID 56845406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).