C12H15N3O5 — CID 4060213
(4-nitrophenyl)methyl 2,5-diamino-5-oxopentanoate (PubChem CID 4060213) has the molecular formula C12H15N3O5 and a molecular weight of 281.27 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2,5-diamino-5-oxopentanoate.
| Compound Name | (4-nitrophenyl)methyl 2,5-diamino-5-oxopentanoate |
|---|---|
| PubChem CID | 4060213 |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | (4-nitrophenyl)methyl 2,5-diamino-5-oxopentanoate |
| SMILES | NC(=O)CCC(N)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H15N3O5/c13-10(5-6-11(14)16)12(17)20-7-8-1-3-9(4-2-8)15(18)19/h1-4,10H,5-7,13H2,(H2,14,16) |
| InChIKey | GREONXVWZTVIIG-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 138.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|