C11H14N4O4S — CID 88528730
(4-nitrophenyl)methyl 3-(diaminomethylideneamino)-2-sulfanylpropanoate (PubChem CID 88528730) has the molecular formula C11H14N4O4S and a molecular weight of 298.32 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-(diaminomethylideneamino)-2-sulfanylpropanoate.
| Compound Name | (4-nitrophenyl)methyl 3-(diaminomethylideneamino)-2-sulfanylpropanoate |
|---|---|
| PubChem CID | 88528730 |
| Molecular Formula | C11H14N4O4S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | (4-nitrophenyl)methyl 3-(diaminomethylideneamino)-2-sulfanylpropanoate |
| SMILES | NC(N)=NCC(S)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H14N4O4S/c12-11(13)14-5-9(20)10(16)19-6-7-1-3-8(4-2-7)15(17)18/h1-4,9,20H,5-6H2,(H4,12,13,14) |
| InChIKey | BAQYKRUTJUZYPF-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 133.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|