C19H18N4O8S — CID 10983428
bis[(4-nitrophenyl)methyl] 4-sulfanylpyrazolidine-1,2-dicarboxylate (PubChem CID 10983428) has the molecular formula C19H18N4O8S and a molecular weight of 462.44 g/mol. Its IUPAC name is bis[(4-nitrophenyl)methyl] 4-sulfanylpyrazolidine-1,2-dicarboxylate.
| Compound Name | bis[(4-nitrophenyl)methyl] 4-sulfanylpyrazolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10983428 |
| Molecular Formula | C19H18N4O8S |
| Molecular Weight | 462.44 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | bis[(4-nitrophenyl)methyl] 4-sulfanylpyrazolidine-1,2-dicarboxylate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)N1CC(S)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H18N4O8S/c24-18(30-11-13-1-5-15(6-2-13)22(26)27)20-9-17(32)10-21(20)19(25)31-12-14-3-7-16(8-4-14)23(28)29/h1-8,17,32H,9-12H2 |
| InChIKey | FATJRYHCXBWSAD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 145.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|