C13H14N6O4S — CID 57119996
(4-nitrophenyl)methyl (2S,4S)-4-sulfanyl-2-(2H-tetrazol-5-yl)pyrrolidine-1-carboxylate (PubChem CID 57119996) has the molecular formula C13H14N6O4S and a molecular weight of 350.36 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4S)-4-sulfanyl-2-(2H-tetrazol-5-yl)pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4S)-4-sulfanyl-2-(2H-tetrazol-5-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57119996 |
| Molecular Formula | C13H14N6O4S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4S)-4-sulfanyl-2-(2H-tetrazol-5-yl)pyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)N1C[C@@H](S)C[C@H]1c1nn[nH]n1 |
| InChI | InChI=1S/C13H14N6O4S/c20-13(23-7-8-1-3-9(4-2-8)19(21)22)18-6-10(24)5-11(18)12-14-16-17-15-12/h1-4,10-11,24H,5-7H2,(H,14,15,16,17)/t10-,11-/m0/s1 |
| InChIKey | VAIFYTBAMPJDMH-QWRGUYRKSA-N |
| XLogP | 1.49 |
| TPSA | 127.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|