C13H15N3O5S — CID 13324681
(4-nitrophenyl)methyl (2S,4S)-2-carbamoyl-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 13324681) has the molecular formula C13H15N3O5S and a molecular weight of 325.35 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4S)-2-carbamoyl-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4S)-2-carbamoyl-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 13324681 |
| Molecular Formula | C13H15N3O5S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4S)-2-carbamoyl-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | NC(=O)[C@@H]1C[C@H](S)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H15N3O5S/c14-12(17)11-5-10(22)6-15(11)13(18)21-7-8-1-3-9(4-2-8)16(19)20/h1-4,10-11,22H,5-7H2,(H2,14,17)/t10-,11-/m0/s1 |
| InChIKey | XYYRIMJKUXHPEM-QWRGUYRKSA-N |
| XLogP | 1.09 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|