C20H22N4O7S2 — CID 90369152
(4-nitrophenyl)methyl (2S,4S)-2-[(4-sulfamoylphenyl)methylcarbamoyl]-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 90369152) has the molecular formula C20H22N4O7S2 and a molecular weight of 494.55 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4S)-2-[(4-sulfamoylphenyl)methylcarbamoyl]-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4S)-2-[(4-sulfamoylphenyl)methylcarbamoyl]-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90369152 |
| Molecular Formula | C20H22N4O7S2 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4S)-2-[(4-sulfamoylphenyl)methylcarbamoyl]-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)[C@@H]2C[C@H](S)CN2C(=O)OCc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C20H22N4O7S2/c21-33(29,30)17-7-3-13(4-8-17)10-22-19(25)18-9-16(32)11-23(18)20(26)31-12-14-1-5-15(6-2-14)24(27)28/h1-8,16,18,32H,9-12H2,(H,22,25)(H2,21,29,30)/t16-,18-/m0/s1 |
| InChIKey | VCJTYCONVSYYMF-WMZOPIPTSA-N |
| XLogP | 1.57 |
| TPSA | 161.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|