C14H17N3O5S2 — CID 19990919
(4-nitrophenyl)methyl 2-(2-amino-2-oxoethyl)sulfanyl-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 19990919) has the molecular formula C14H17N3O5S2 and a molecular weight of 371.44 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-(2-amino-2-oxoethyl)sulfanyl-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 2-(2-amino-2-oxoethyl)sulfanyl-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 19990919 |
| Molecular Formula | C14H17N3O5S2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | (4-nitrophenyl)methyl 2-(2-amino-2-oxoethyl)sulfanyl-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | NC(=O)CSC1CC(S)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H17N3O5S2/c15-12(18)8-24-13-5-11(23)6-16(13)14(19)22-7-9-1-3-10(4-2-9)17(20)21/h1-4,11,13,23H,5-8H2,(H2,15,18) |
| InChIKey | PQRJRNJACGYATF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|