C27H31N5O9S — CID 86751994
(4-nitrophenyl)methyl (2R,5S)-2,5-dimethyl-4-[(2S,4S)-1-[(4-nitrophenyl)methoxycarbonyl]-4-sulfanylpyrrolidine-2-carbonyl]piperazine-1-carboxylate (PubChem CID 86751994) has the molecular formula C27H31N5O9S and a molecular weight of 601.64 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2R,5S)-2,5-dimethyl-4-[(2S,4S)-1-[(4-nitrophenyl)methoxycarbonyl]-4-sulfanylpyrrolidine-2-carbonyl]piperazine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2R,5S)-2,5-dimethyl-4-[(2S,4S)-1-[(4-nitrophenyl)methoxycarbonyl]-4-sulfanylpyrrolidine-2-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 86751994 |
| Molecular Formula | C27H31N5O9S |
| Molecular Weight | 601.64 g/mol |
| Exact Mass | 601.18 |
| IUPAC Name | (4-nitrophenyl)methyl (2R,5S)-2,5-dimethyl-4-[(2S,4S)-1-[(4-nitrophenyl)methoxycarbonyl]-4-sulfanylpyrrolidine-2-carbonyl]piperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)[C@@H]2C[C@H](S)CN2C(=O)OCc2ccc([N+](=O)[O-])cc2)[C@@H](C)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H31N5O9S/c1-17-13-29(26(34)40-15-19-3-7-21(8-4-19)31(36)37)18(2)12-28(17)25(33)24-11-23(42)14-30(24)27(35)41-16-20-5-9-22(10-6-20)32(38)39/h3-10,17-18,23-24,42H,11-16H2,1-2H3/t17-,18+,23-,24-/m0/s1 |
| InChIKey | UPIJNURNLUTQCG-VBVDBJQASA-N |
| XLogP | 3.77 |
| TPSA | 165.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.64 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|