C26H29N5O9S — CID 86753699
(4-nitrophenyl)methyl (2S,4S)-2-[4-[2-[(4-nitrophenyl)methoxy]-2-oxoethyl]piperazine-1-carbonyl]-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 86753699) has the molecular formula C26H29N5O9S and a molecular weight of 587.61 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4S)-2-[4-[2-[(4-nitrophenyl)methoxy]-2-oxoethyl]piperazine-1-carbonyl]-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4S)-2-[4-[2-[(4-nitrophenyl)methoxy]-2-oxoethyl]piperazine-1-carbonyl]-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86753699 |
| Molecular Formula | C26H29N5O9S |
| Molecular Weight | 587.61 g/mol |
| Exact Mass | 587.17 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4S)-2-[4-[2-[(4-nitrophenyl)methoxy]-2-oxoethyl]piperazine-1-carbonyl]-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | O=C(CN1CCN(C(=O)[C@@H]2C[C@H](S)CN2C(=O)OCc2ccc([N+](=O)[O-])cc2)CC1)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H29N5O9S/c32-24(39-16-18-1-5-20(6-2-18)30(35)36)15-27-9-11-28(12-10-27)25(33)23-13-22(41)14-29(23)26(34)40-17-19-3-7-21(8-4-19)31(37)38/h1-8,22-23,41H,9-17H2/t22-,23-/m0/s1 |
| InChIKey | OHZPWMAFPFPFBI-GOTSBHOMSA-N |
| XLogP | 2.40 |
| TPSA | 165.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.61 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|