C22H29N5O7S — CID 139665065
(4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-[4-(2-amino-2-oxoethyl)-1,4-diazepane-1-carbonyl]pyrrolidine-1-carboxylate (PubChem CID 139665065) has the molecular formula C22H29N5O7S and a molecular weight of 507.57 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-[4-(2-amino-2-oxoethyl)-1,4-diazepane-1-carbonyl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-[4-(2-amino-2-oxoethyl)-1,4-diazepane-1-carbonyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139665065 |
| Molecular Formula | C22H29N5O7S |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-[4-(2-amino-2-oxoethyl)-1,4-diazepane-1-carbonyl]pyrrolidine-1-carboxylate |
| SMILES | CC(=O)S[C@H]1C[C@@H](C(=O)N2CCCN(CC(N)=O)CC2)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C22H29N5O7S/c1-15(28)35-18-11-19(21(30)25-8-2-7-24(9-10-25)13-20(23)29)26(12-18)22(31)34-14-16-3-5-17(6-4-16)27(32)33/h3-6,18-19H,2,7-14H2,1H3,(H2,23,29)/t18-,19-/m0/s1 |
| InChIKey | KZOOOVFQZZBCMQ-OALUTQOASA-N |
| XLogP | 0.97 |
| TPSA | 156.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|