C26H28N4O10S — CID 15459661
(4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-[hydroxy-[1-[(4-nitrophenyl)methoxycarbonyl]azetidin-3-yl]methyl]pyrrolidine-1-carboxylate (PubChem CID 15459661) has the molecular formula C26H28N4O10S and a molecular weight of 588.60 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-[hydroxy-[1-[(4-nitrophenyl)methoxycarbonyl]azetidin-3-yl]methyl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-[hydroxy-[1-[(4-nitrophenyl)methoxycarbonyl]azetidin-3-yl]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 15459661 |
| Molecular Formula | C26H28N4O10S |
| Molecular Weight | 588.60 g/mol |
| Exact Mass | 588.15 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-[hydroxy-[1-[(4-nitrophenyl)methoxycarbonyl]azetidin-3-yl]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(=O)S[C@H]1C[C@@H](C(O)C2CN(C(=O)OCc3ccc([N+](=O)[O-])cc3)C2)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C26H28N4O10S/c1-16(31)41-22-10-23(28(13-22)26(34)40-15-18-4-8-21(9-5-18)30(37)38)24(32)19-11-27(12-19)25(33)39-14-17-2-6-20(7-3-17)29(35)36/h2-9,19,22-24,32H,10-15H2,1H3/t22-,23-,24?/m0/s1 |
| InChIKey | LHKQYQRMXBEYME-NTZARQNWSA-N |
| XLogP | 3.49 |
| TPSA | 182.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.60 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|