C19H24IN3O6S2 — CID 18915352
(4-nitrophenyl)methyl 4-acetylsulfanyl-2-[3-(iodomethylamino)-2-methyl-3-oxo-1-sulfanylpropyl]pyrrolidine-1-carboxylate (PubChem CID 18915352) has the molecular formula C19H24IN3O6S2 and a molecular weight of 581.45 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 4-acetylsulfanyl-2-[3-(iodomethylamino)-2-methyl-3-oxo-1-sulfanylpropyl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 4-acetylsulfanyl-2-[3-(iodomethylamino)-2-methyl-3-oxo-1-sulfanylpropyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 18915352 |
| Molecular Formula | C19H24IN3O6S2 |
| Molecular Weight | 581.45 g/mol |
| Exact Mass | 581.02 |
| IUPAC Name | (4-nitrophenyl)methyl 4-acetylsulfanyl-2-[3-(iodomethylamino)-2-methyl-3-oxo-1-sulfanylpropyl]pyrrolidine-1-carboxylate |
| SMILES | CC(=O)SC1CC(C(S)C(C)C(=O)NCI)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C19H24IN3O6S2/c1-11(18(25)21-10-20)17(30)16-7-15(31-12(2)24)8-22(16)19(26)29-9-13-3-5-14(6-4-13)23(27)28/h3-6,11,15-17,30H,7-10H2,1-2H3,(H,21,25) |
| InChIKey | FBNNZSYNHSLXKB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|