C18H22N2O5S3 — CID 18638812
(4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-(1,3-dithian-2-yl)pyrrolidine-1-carboxylate (PubChem CID 18638812) has the molecular formula C18H22N2O5S3 and a molecular weight of 442.58 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-(1,3-dithian-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-(1,3-dithian-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 18638812 |
| Molecular Formula | C18H22N2O5S3 |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-(1,3-dithian-2-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(=O)S[C@H]1C[C@@H](C2SCCCS2)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C18H22N2O5S3/c1-12(21)28-15-9-16(17-26-7-2-8-27-17)19(10-15)18(22)25-11-13-3-5-14(6-4-13)20(23)24/h3-6,15-17H,2,7-11H2,1H3/t15-,16-/m0/s1 |
| InChIKey | IVBWQJGAAJJTDZ-HOTGVXAUSA-N |
| XLogP | 4.15 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|