C24H26N4O10S — CID 10674439
(4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-[(1R)-1-hydroxy-2-[(4-nitrophenyl)methoxycarbonylamino]ethyl]pyrrolidine-1-carboxylate (PubChem CID 10674439) has the molecular formula C24H26N4O10S and a molecular weight of 562.56 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-[(1R)-1-hydroxy-2-[(4-nitrophenyl)methoxycarbonylamino]ethyl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-[(1R)-1-hydroxy-2-[(4-nitrophenyl)methoxycarbonylamino]ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10674439 |
| Molecular Formula | C24H26N4O10S |
| Molecular Weight | 562.56 g/mol |
| Exact Mass | 562.14 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-[(1R)-1-hydroxy-2-[(4-nitrophenyl)methoxycarbonylamino]ethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(=O)S[C@H]1C[C@@H]([C@H](O)CNC(=O)OCc2ccc([N+](=O)[O-])cc2)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C24H26N4O10S/c1-15(29)39-20-10-21(26(12-20)24(32)38-14-17-4-8-19(9-5-17)28(35)36)22(30)11-25-23(31)37-13-16-2-6-18(7-3-16)27(33)34/h2-9,20-22,30H,10-14H2,1H3,(H,25,31)/t20-,21-,22+/m0/s1 |
| InChIKey | NACZUEBMTZRHGA-FDFHNCONSA-N |
| XLogP | 3.15 |
| TPSA | 191.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.56 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|