C29H34N4O10S2 — CID 139659186
(4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-[(1R)-1-hydroxy-3-[(3S)-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-3-yl]sulfanylpropyl]pyrrolidine-1-carboxylate (PubChem CID 139659186) has the molecular formula C29H34N4O10S2 and a molecular weight of 662.74 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-[(1R)-1-hydroxy-3-[(3S)-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-3-yl]sulfanylpropyl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-[(1R)-1-hydroxy-3-[(3S)-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-3-yl]sulfanylpropyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139659186 |
| Molecular Formula | C29H34N4O10S2 |
| Molecular Weight | 662.74 g/mol |
| Exact Mass | 662.17 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-[(1R)-1-hydroxy-3-[(3S)-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-3-yl]sulfanylpropyl]pyrrolidine-1-carboxylate |
| SMILES | CC(=O)S[C@H]1C[C@@H]([C@H](O)CCS[C@H]2CCN(C(=O)OCc3ccc([N+](=O)[O-])cc3)C2)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C29H34N4O10S2/c1-19(34)45-25-14-26(31(16-25)29(37)43-18-21-4-8-23(9-5-21)33(40)41)27(35)11-13-44-24-10-12-30(15-24)28(36)42-17-20-2-6-22(7-3-20)32(38)39/h2-9,24-27,35H,10-18H2,1H3/t24-,25-,26-,27+/m0/s1 |
| InChIKey | NHASXFKOHNUOPZ-YIPNQBBMSA-N |
| XLogP | 4.76 |
| TPSA | 182.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.74 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|