C30H38N4O12S2 — CID 139659177
(4-nitrophenyl)methyl (2S,4R)-2-[(1R)-1-hydroxy-3-[1-[(4-nitrophenyl)methoxycarbonyl]piperidin-4-yl]sulfanylpropyl]-4-methylsulfonyloxypiperidine-1-carboxylate (PubChem CID 139659177) has the molecular formula C30H38N4O12S2 and a molecular weight of 710.78 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4R)-2-[(1R)-1-hydroxy-3-[1-[(4-nitrophenyl)methoxycarbonyl]piperidin-4-yl]sulfanylpropyl]-4-methylsulfonyloxypiperidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4R)-2-[(1R)-1-hydroxy-3-[1-[(4-nitrophenyl)methoxycarbonyl]piperidin-4-yl]sulfanylpropyl]-4-methylsulfonyloxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 139659177 |
| Molecular Formula | C30H38N4O12S2 |
| Molecular Weight | 710.78 g/mol |
| Exact Mass | 710.19 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4R)-2-[(1R)-1-hydroxy-3-[1-[(4-nitrophenyl)methoxycarbonyl]piperidin-4-yl]sulfanylpropyl]-4-methylsulfonyloxypiperidine-1-carboxylate |
| SMILES | CS(=O)(=O)O[C@@H]1CCN(C(=O)OCc2ccc([N+](=O)[O-])cc2)[C@H]([C@H](O)CCSC2CCN(C(=O)OCc3ccc([N+](=O)[O-])cc3)CC2)C1 |
| InChI | InChI=1S/C30H38N4O12S2/c1-48(42,43)46-25-10-16-32(30(37)45-20-22-4-8-24(9-5-22)34(40)41)27(18-25)28(35)13-17-47-26-11-14-31(15-12-26)29(36)44-19-21-2-6-23(7-3-21)33(38)39/h2-9,25-28,35H,10-20H2,1H3/t25-,27+,28-/m1/s1 |
| InChIKey | LRTDIGHMVVXROT-FPNNDXFKSA-N |
| XLogP | 4.23 |
| TPSA | 208.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.78 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|