C16H21N3O9S — CID 18641549
(4-nitrophenyl)methyl (2S,4R)-2-[(2-amino-2-oxoethoxy)methyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate (PubChem CID 18641549) has the molecular formula C16H21N3O9S and a molecular weight of 431.42 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4R)-2-[(2-amino-2-oxoethoxy)methyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4R)-2-[(2-amino-2-oxoethoxy)methyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 18641549 |
| Molecular Formula | C16H21N3O9S |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4R)-2-[(2-amino-2-oxoethoxy)methyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
| SMILES | CS(=O)(=O)O[C@@H]1C[C@@H](COCC(N)=O)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C16H21N3O9S/c1-29(24,25)28-14-6-13(9-26-10-15(17)20)18(7-14)16(21)27-8-11-2-4-12(5-3-11)19(22)23/h2-5,13-14H,6-10H2,1H3,(H2,17,20)/t13-,14+/m0/s1 |
| InChIKey | MEMXXWYDOJPVBT-UONOGXRCSA-N |
| XLogP | 0.15 |
| TPSA | 168.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|