C18H24N4O9S2 — CID 76500494
(4-nitrophenyl)methyl 2-[[2-[carbamoyl(methyl)amino]-2-oxoethyl]sulfanylmethyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate (PubChem CID 76500494) has the molecular formula C18H24N4O9S2 and a molecular weight of 504.54 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[[2-[carbamoyl(methyl)amino]-2-oxoethyl]sulfanylmethyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 2-[[2-[carbamoyl(methyl)amino]-2-oxoethyl]sulfanylmethyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 76500494 |
| Molecular Formula | C18H24N4O9S2 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[[2-[carbamoyl(methyl)amino]-2-oxoethyl]sulfanylmethyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
| SMILES | CN(C(N)=O)C(=O)CSCC1CC(OS(C)(=O)=O)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H24N4O9S2/c1-20(17(19)24)16(23)11-32-10-14-7-15(31-33(2,28)29)8-21(14)18(25)30-9-12-3-5-13(6-4-12)22(26)27/h3-6,14-15H,7-11H2,1-2H3,(H2,19,24) |
| InChIKey | HJCQMEIKQMBEMS-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 179.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|